EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N2O4 |
| Net Charge | 0 |
| Average Mass | 266.297 |
| Monoisotopic Mass | 266.12666 |
| SMILES | COc1ccc(CNC(=O)CCC(N)C(=O)O)cc1 |
| InChI | InChI=1S/C13H18N2O4/c1-19-10-4-2-9(3-5-10)8-15-12(16)7-6-11(14)13(17)18/h2-5,11H,6-8,14H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | MLNAECTVQFEWFD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N5-(4-methoxybenzyl)glutamine (CHEBI:143249) is a α-amino acid (CHEBI:33704) |
| Manual Xrefs | Databases |
|---|---|
| 131751461 | PubChem Compound |