EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10N2O3 |
| Net Charge | 0 |
| Average Mass | 158.157 |
| Monoisotopic Mass | 158.06914 |
| SMILES | CC1(C)C(=O)NC(=O)N1CO |
| InChI | InChI=1S/C6H10N2O3/c1-6(2)4(10)7-5(11)8(6)3-9/h9H,3H2,1-2H3,(H,7,10,11) |
| InChIKey | SIQZJFKTROUNPI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(hydroxymethyl)-5,5-dimethylhydantoin (CHEBI:143246) has role antimicrobial agent (CHEBI:33281) |
| 1-(hydroxymethyl)-5,5-dimethylhydantoin (CHEBI:143246) is a hemiaminal (CHEBI:73080) |
| 1-(hydroxymethyl)-5,5-dimethylhydantoin (CHEBI:143246) is a imidazolidine-2,4-dione (CHEBI:24628) |
| IUPAC Name |
|---|
| 1-(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione |
| Synonyms | Source |
|---|---|
| 1-hydroxymethyl-5,5-dimethyl-2,4-imidazolidinedione | ChEBI |
| 1-(hydroxymethyl)-5,5-dimethyl-2,4-imidazolidinedione | ChEBI |
| 1-hydroxymethyl-5,5-dimethylhydantoin | ChEBI |
| 1-(hydroxymethyl)-5,5-dimethylhydantoin | ChEBI |
| 1-methylol-5,5-dimethylhydantoin | ChEBI |
| 1-monomethylol-5,5-dimethylhydantoin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 67000 | PubChem Compound |
| HMDB0031670 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:139160 | Reaxys |
| CAS:116-25-6 | ChemIDplus |
| CAS:27636-82-4 | ChemIDplus |
| Citations |
|---|