EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7NO |
| Net Charge | 0 |
| Average Mass | 145.161 |
| Monoisotopic Mass | 145.05276 |
| SMILES | [H]C(=O)c1cccc2nccc12 |
| InChI | InChI=1S/C9H7NO/c11-6-7-2-1-3-9-8(7)4-5-10-9/h1-6,10H |
| InChIKey | JFDDFGLNZWNJTK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sargassum thunbergii (ncbitaxon:127542) | - | PubMed (28417922) |
| Roles Classification |
|---|
| Biological Role: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indole-4-carbaldehyde (CHEBI:143235) has role algal metabolite (CHEBI:84735) |
| indole-4-carbaldehyde (CHEBI:143235) is a heteroarenecarbaldehyde (CHEBI:49104) |
| indole-4-carbaldehyde (CHEBI:143235) is a indoles (CHEBI:24828) |
| IUPAC Name |
|---|
| 1H-indole-4-carbaldehyde |
| Synonyms | Source |
|---|---|
| 1H-indole-4-carboxaldehyde | ChEBI |
| 4-formyl-1H-indole | ChEBI |
| 4-formylindole | ChEBI |
| 4-indolealdehyde | ChEBI |
| 4-indolecarbaldehyde | ChEBI |
| 4-indole-carboxaldehyde | ChEBI |
| Citations |
|---|