EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H46NO7P |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 242.144 |
| Monoisotopic Mass (excl. R groups) | 242.04296 |
| SMILES | *C(=O)OC[C@@]([H])(O)COP(=O)(O)OCCN |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PE(20:3/0:0) (CHEBI:143227) is a lysophosphatidylethanolamine 20:3 (CHEBI:72735) |
| Incoming Relation(s) |
| 1-dihomo-linolenoyl-GPE (20:3n3 or n6) (CHEBI:234061) is a PE(20:3/0:0) (CHEBI:143227) |
| PE(20:3(8Z,11Z,14Z)/0:0) (CHEBI:145285) is a PE(20:3/0:0) (CHEBI:143227) |
| Synonyms | Source |
|---|---|
| LPE 20:3/0:0 | SUBMITTER |
| LPE(20:3/0:0) | SUBMITTER |
| LysoPE 20:3/0:0 | SUBMITTER |
| LysoPE(20:3/0:0) | SUBMITTER |
| lysophosphatidylethanolamine 20:3/0:0 | SUBMITTER |
| lysophosphatidylethanolamine(20:3/0:0) | SUBMITTER |