EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15N3O4 |
| Net Charge | 0 |
| Average Mass | 205.214 |
| Monoisotopic Mass | 205.10626 |
| SMILES | CNC(=O)N(O)CCC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C7H15N3O4/c1-9-7(13)10(14)4-2-3-5(8)6(11)12/h5,14H,2-4,8H2,1H3,(H,9,13)(H,11,12)/t5-/m0/s1 |
| InChIKey | BFAJHARTSOPNFL-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nδ-hydroxy-Nω-methyl-L-citrulline zwitterion (CHEBI:143210) has functional parent L-citrulline zwitterion (CHEBI:57743) |
| Nδ-hydroxy-Nω-methyl-L-citrulline zwitterion (CHEBI:143210) is a amino-acid zwitterion (CHEBI:35238) |
| Nδ-hydroxy-Nω-methyl-L-citrulline zwitterion (CHEBI:143210) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| UniProt Name | Source |
|---|---|
| Nδ-hydroxy-Nω-methyl-L-citrulline | UniProt |
| Citations |
|---|