EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O2 |
| Net Charge | 0 |
| Average Mass | 238.371 |
| Monoisotopic Mass | 238.19328 |
| SMILES | [H][C@]12[C@H](O)C[C@]3(C)[C@H](O)[C@@]1([H])C(C)(C)CCC[C@]23C |
| InChI | InChI=1S/C15H26O2/c1-13(2)6-5-7-14(3)10-9(16)8-15(14,4)12(17)11(10)13/h9-12,16-17H,5-8H2,1-4H3/t9-,10+,11+,12-,14-,15-/m1/s1 |
| InChIKey | VWMGBHVRRNKOAE-ZLSAFIHNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium culmorum (ncbitaxon:5516) | - | PubMed (16746350) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. mycotoxin Poisonous substance produced by fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| culmorin (CHEBI:143197) has role fungal metabolite (CHEBI:76946) |
| culmorin (CHEBI:143197) has role mycotoxin (CHEBI:25442) |
| culmorin (CHEBI:143197) is a carbotricyclic compound (CHEBI:38032) |
| culmorin (CHEBI:143197) is a diol (CHEBI:23824) |
| culmorin (CHEBI:143197) is a secondary alcohol (CHEBI:35681) |
| culmorin (CHEBI:143197) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (1S,3R,3aS,4R,8aR,9R)-1,5,5,8a-tetramethyldecahydro-1,4-methanoazulene-3,9-diol |
| Synonym | Source |
|---|---|
| (−)-culmorin | ChEBI |
| UniProt Name | Source |
|---|---|
| culmorin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00021971 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:18374-83-9 | KNApSAcK |
| CAS:18374-83-9 | ChemIDplus |
| Citations |
|---|