EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8ClNO3 |
| Net Charge | 0 |
| Average Mass | 237.642 |
| Monoisotopic Mass | 237.01927 |
| SMILES | O=C(O)COc1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C11H8ClNO3/c12-8-3-4-9(16-6-10(14)15)11-7(8)2-1-5-13-11/h1-5H,6H2,(H,14,15) |
| InChIKey | ICJSJAJWTWPSBD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | herbicide safener A compound used with herbicides that reduces the effect of the herbicide on crop plants or otherwise improves the selectivity of the herbicide for weed species over the crop plant. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cloquintocet (CHEBI:143146) has role herbicide safener (CHEBI:132272) |
| cloquintocet (CHEBI:143146) is a aromatic ether (CHEBI:35618) |
| cloquintocet (CHEBI:143146) is a monocarboxylic acid (CHEBI:25384) |
| cloquintocet (CHEBI:143146) is a organochlorine compound (CHEBI:36683) |
| cloquintocet (CHEBI:143146) is a quinolines (CHEBI:26513) |
| IUPAC Name |
|---|
| [(5-chloroquinolin-8-yl)oxy]acetic acid |
| Synonyms | Source |
|---|---|
| [(5-chloro-8-quinolinyl)oxy]acetic acid | ChEBI |
| cloquintocet | ChemIDplus |
| 2-[(5-chloro-8-quinolinyl)oxy]acetic acid | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| cloquintocet | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9932835 | Reaxys |
| CAS:88349-88-6 | ChemIDplus |
| Citations |
|---|