EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23FeN3O4S3 |
| Net Charge | 0 |
| Average Mass | 533.478 |
| Monoisotopic Mass | 533.02001 |
| SMILES | [H][C@]12[O][Fe]345([O]C(=O)[C@@]6(C)CSC(=[N]63)C1(C)C)[O]c1ccccc1C1=[N]4[C@]([H])(CS1)C1SC[C@]2([H])[N]15 |
| InChI | InChI=1S/C21H25N3O4S3.Fe/c1-20(2,18-24-21(3,10-31-18)19(27)28)15(26)12-8-30-17(22-12)13-9-29-16(23-13)11-6-4-5-7-14(11)25;/h4-7,12-13,15,17,25H,8-10H2,1-3H3,(H,27,28);/q-2;+4/p-2/t12-,13+,15+,17?,21+;/m0./s1 |
| InChIKey | CLXCFZCRXPNFHJ-AOWBWOEMSA-L |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. virulence factor Any toxin secreted by bacteria, viruses, fungi or protozoa enabling them to achieve colonisation of a niche in the host, inhibit or evade the host's immune response, enter and exit cells, or obtain nutrition from the host. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferric yersiniabactin (CHEBI:143131) has part iron(3+) (CHEBI:29034) |
| ferric yersiniabactin (CHEBI:143131) has part yersiniabactin(1−) (CHEBI:149525) |
| ferric yersiniabactin (CHEBI:143131) has role bacterial metabolite (CHEBI:76969) |
| ferric yersiniabactin (CHEBI:143131) has role virulence factor (CHEBI:72316) |
| ferric yersiniabactin (CHEBI:143131) is a Fe(III)-complexed siderophore (CHEBI:84734) |
| Synonyms | Source |
|---|---|
| ferric Ybt | SUBMITTER |
| yersiniabactin-Fe(III) | SUBMITTER |
| ferric-yersiniabactin | ChEBI |
| Fe(III)-yersiniabactin | ChEBI |
| Citations |
|---|