EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22BrNO |
| Net Charge | 0 |
| Average Mass | 396.328 |
| Monoisotopic Mass | 395.08848 |
| SMILES | O=C1/C(=C/c2ccccc2)C(NC2CCCCC2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C22H22BrNO/c23-16-11-12-18-19(14-16)21(24-17-9-5-2-6-10-17)20(22(18)25)13-15-7-3-1-4-8-15/h1,3-4,7-8,11-14,17,21,24H,2,5-6,9-10H2/b20-13+ |
| InChIKey | JGWQWVVSCQBAFC-DEDYPNTBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BCI-215 (CHEBI:143128) has role antineoplastic agent (CHEBI:35610) |
| BCI-215 (CHEBI:143128) has role apoptosis inducer (CHEBI:68495) |
| BCI-215 (CHEBI:143128) is a aromatic ketone (CHEBI:76224) |
| BCI-215 (CHEBI:143128) is a enone (CHEBI:51689) |
| BCI-215 (CHEBI:143128) is a indanones (CHEBI:24789) |
| BCI-215 (CHEBI:143128) is a organobromine compound (CHEBI:37141) |
| BCI-215 (CHEBI:143128) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| (2E)-2-benzylidene-5-bromo-3-(cyclohexylamino)-2,3-dihydro-1H-inden-1-one |
| Registry Numbers | Sources |
|---|---|
| CAS:1245792-67-9 | ChEBI |
| Citations |
|---|