EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H32ClN7O2 |
| Net Charge | 0 |
| Average Mass | 558.086 |
| Monoisotopic Mass | 557.23060 |
| SMILES | [H][C@@]1(Nc2ncc(Cl)c(-c3cnc4ccccc34)n2)CCCN(C(=O)c2ccc(NC(=O)/C=C/CN(C)C)cc2)C1 |
| InChI | InChI=1S/C30H32ClN7O2/c1-37(2)15-6-10-27(39)34-21-13-11-20(12-14-21)29(40)38-16-5-7-22(19-38)35-30-33-18-25(31)28(36-30)24-17-32-26-9-4-3-8-23(24)26/h3-4,6,8-14,17-18,22,32H,5,7,15-16,19H2,1-2H3,(H,34,39)(H,33,35,36)/b10-6+/t22-/m1/s1 |
| InChIKey | RUBYHLPRZRMTJO-MOVYNIQHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| THZ531 (CHEBI:143122) has role antineoplastic agent (CHEBI:35610) |
| THZ531 (CHEBI:143122) has role apoptosis inducer (CHEBI:68495) |
| THZ531 (CHEBI:143122) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| THZ531 (CHEBI:143122) is a N-acylpiperidine (CHEBI:48591) |
| THZ531 (CHEBI:143122) is a aminopyrimidine (CHEBI:38338) |
| THZ531 (CHEBI:143122) is a enamide (CHEBI:51751) |
| THZ531 (CHEBI:143122) is a indoles (CHEBI:24828) |
| THZ531 (CHEBI:143122) is a organochlorine compound (CHEBI:36683) |
| THZ531 (CHEBI:143122) is a secondary amino compound (CHEBI:50995) |
| THZ531 (CHEBI:143122) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (2E)-N-(4-{[(3R)-3-{[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino}piperidin-1-yl]carbonyl}phenyl)-4-(dimethylamino)but-2-enamide |
| Synonyms | Source |
|---|---|
| (E)-N-[4-[(3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]piperidine-1-carbonyl]phenyl]-4-(dimethylamino)but-2-enamide | ChEBI |
| (R,E)-N-(4-(3-((5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl)amino)piperidine-1-carbonyl)phenyl)-4-(dimethylamino)but-2-enamide | ChEBI |
| THZ-531 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1702809-17-3 | ChEBI |
| Citations |
|---|