EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H15N3O4 |
| Net Charge | 0 |
| Average Mass | 385.379 |
| Monoisotopic Mass | 385.10626 |
| SMILES | COc1ccc2nc3c4nc5ccc(OC)cc5c4c4c(c3c2c1)C(=O)NC4=O |
| InChI | InChI=1S/C22H15N3O4/c1-28-9-3-5-13-11(7-9)15-17-18(22(27)25-21(17)26)16-12-8-10(29-2)4-6-14(12)24-20(16)19(15)23-13/h3-8,23-24H,1-2H3,(H,25,26,27) |
| InChIKey | LGTURXDQKJRHSF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GW296115X (CHEBI:143121) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| GW296115X (CHEBI:143121) is a aromatic ether (CHEBI:35618) |
| GW296115X (CHEBI:143121) is a indolocarbazole (CHEBI:51915) |
| GW296115X (CHEBI:143121) is a organic heterohexacyclic compound (CHEBI:51914) |
| IUPAC Name |
|---|
| 3,9-dimethoxy-12,13-dihydro-5H-indolo[2,3-a]pyrrolo[3,4-c]carbazole-5,7(6H)-dione |
| Synonyms | Source |
|---|---|
| 12,13-dihydro-3,9-dimethoxy-5H-Indolo[2,3-a]pyrrolo[3,4-c]carbazole-5,7(6H)-dione | ChEBI |
| 3744-W | ChEBI |
| 3744W | ChEBI |
| GW296115 | ChEBI |
| GW296115X | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:118458-58-5 | ChEBI |
| Citations |
|---|