EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19FN6O2 |
| Net Charge | 0 |
| Average Mass | 406.421 |
| Monoisotopic Mass | 406.15535 |
| SMILES | C[C@H]1Oc2cc(cnc2N)-c2c(nn(C)c2C#N)CN(C)C(=O)c2ccc(F)cc21 |
| InChI | InChI=1S/C21H19FN6O2/c1-11-15-7-13(22)4-5-14(15)21(29)27(2)10-16-19(17(8-23)28(3)26-16)12-6-18(30-11)20(24)25-9-12/h4-7,9,11H,10H2,1-3H3,(H2,24,25)/t11-/m1/s1 |
| InChIKey | IIXWYSCJSQVBQM-LLVKDONJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lorlatinib (CHEBI:143117) has role antineoplastic agent (CHEBI:35610) |
| lorlatinib (CHEBI:143117) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| lorlatinib (CHEBI:143117) is a aminopyridine (CHEBI:38207) |
| lorlatinib (CHEBI:143117) is a aromatic ether (CHEBI:35618) |
| lorlatinib (CHEBI:143117) is a azamacrocycle (CHEBI:52898) |
| lorlatinib (CHEBI:143117) is a benzamides (CHEBI:22702) |
| lorlatinib (CHEBI:143117) is a cyclic ether (CHEBI:37407) |
| lorlatinib (CHEBI:143117) is a monofluorobenzenes (CHEBI:83575) |
| lorlatinib (CHEBI:143117) is a nitrile (CHEBI:18379) |
| lorlatinib (CHEBI:143117) is a organic heterotetracyclic compound (CHEBI:38163) |
| lorlatinib (CHEBI:143117) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| (10R)-7-amino-12-fluoro-2,10,16-trimethyl-15-oxo-10,15,16,17-tetrahydro-2H-8,4-(metheno)pyrazolo[4,3-h][2,5,11]benzoxadiazacyclotetradecine-3-carbonitrile |
| INNs | Source |
|---|---|
| lorlatinib | WHO MedNet |
| lorlatinib | WHO MedNet |
| lorlatinib | WHO MedNet |
| lorlatinibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| loratinib | ChemIDplus |
| PF-06463922 | ChemIDplus |
| PF06463922 | ChEBI |
| PFE-PKIS 10 | ChEBI |
| Brand Name | Source |
|---|---|
| Lorbrena | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 5P8 | PDBeChem |
| D11012 | KEGG DRUG |
| DB12130 | DrugBank |
| Lorlatinib | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1454846-35-5 | ChemIDplus |
| Citations |
|---|