EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19N3O2 |
| Net Charge | 0 |
| Average Mass | 273.336 |
| Monoisotopic Mass | 273.14773 |
| SMILES | CC/C(NN(C)C)=C1\C(=O)Nc2ccc(C(C)=O)cc21 |
| InChI | InChI=1S/C15H19N3O2/c1-5-12(17-18(3)4)14-11-8-10(9(2)19)6-7-13(11)16-15(14)20/h6-8,17H,5H2,1-4H3,(H,16,20)/b14-12+ |
| InChIKey | DVQQRISDKCELNQ-WYMLVPIESA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.12.* [dual-specificity kinases (those acting on Ser/Thr and Tyr residues)] inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of duals specificity kinases acting on Ser/Thr and Tyr residues. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BI00036838 (CHEBI:143116) has role EC 2.7.12.* [dual-specificity kinases (those acting on Ser/Thr and Tyr residues)] inhibitor (CHEBI:88285) |
| BI00036838 (CHEBI:143116) is a aromatic ketone (CHEBI:76224) |
| BI00036838 (CHEBI:143116) is a hydrazines (CHEBI:24631) |
| BI00036838 (CHEBI:143116) is a methyl ketone (CHEBI:51867) |
| BI00036838 (CHEBI:143116) is a oxindoles (CHEBI:38459) |
| IUPAC Name |
|---|
| (3E)-5-acetyl-3-[1-(2,2-dimethylhydrazinyl)propylidene]-1,3-dihydro-2H-indol-2-one |
| Synonym | Source |
|---|---|
| (E)-5-acetyl-3-(1-(2,2-dimethylhydrazineyl)propylidene)indolin-2-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| WO2005087727 | Patent |