EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24ClN5O |
| Net Charge | 0 |
| Average Mass | 421.932 |
| Monoisotopic Mass | 421.16694 |
| SMILES | Cn1cc(-c2ccc(-c3cncc(Cl)c3N3CCC4(CCNC4=O)CC3)cc2)cn1 |
| InChI | InChI=1S/C23H24ClN5O/c1-28-15-18(12-27-28)16-2-4-17(5-3-16)19-13-25-14-20(24)21(19)29-10-7-23(8-11-29)6-9-26-22(23)30/h2-5,12-15H,6-11H2,1H3,(H,26,30) |
| InChIKey | LBFYQISQYCGDDW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). Wnt signalling inhibitor A substance that inhibits any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CCT251545 (CHEBI:143114) has role antineoplastic agent (CHEBI:35610) |
| CCT251545 (CHEBI:143114) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| CCT251545 (CHEBI:143114) has role Wnt signalling inhibitor (CHEBI:78031) |
| CCT251545 (CHEBI:143114) is a azaspiro compound (CHEBI:35624) |
| CCT251545 (CHEBI:143114) is a chloropyridine (CHEBI:39173) |
| CCT251545 (CHEBI:143114) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| 8-{3-chloro-5-[4-(1-methyl-1H-pyrazol-4-yl)phenyl]pyridin-4-yl}-2,8-diazaspiro[4.5]decan-1-one |
| Synonyms | Source |
|---|---|
| 8-[3-chloro-5-[4-(1-methylpyrazol-4-yl)phenyl]pyridin-4-yl]-2,8-diazaspiro[4.5]decan-1-one | ChEBI |
| 8-[3-Chloro-5-[4-(1-methyl-1H-pyrazole-4-yl)phenyl]-4-pyridyl]-2,8-diazaspiro[4.5]decane-1-one | ChEBI |
| CCT251545 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4TV | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:1661839-45-7 | ChEBI |
| Citations |
|---|