EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO2 |
| Net Charge | 0 |
| Average Mass | 151.165 |
| Monoisotopic Mass | 151.06333 |
| SMILES | CC(=O)Nc1ccccc1O |
| InChI | InChI=1S/C8H9NO2/c1-6(10)9-7-4-2-3-5-8(7)11/h2-5,11H,1H3,(H,9,10) |
| InChIKey | ADVGKWPZRIDURE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antirheumatic drug A drug used to treat rheumatoid arthritis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-acetamidophenol (CHEBI:143107) has role anti-inflammatory agent (CHEBI:67079) |
| 2-acetamidophenol (CHEBI:143107) has role antineoplastic agent (CHEBI:35610) |
| 2-acetamidophenol (CHEBI:143107) has role antirheumatic drug (CHEBI:35842) |
| 2-acetamidophenol (CHEBI:143107) has role apoptosis inducer (CHEBI:68495) |
| 2-acetamidophenol (CHEBI:143107) has role platelet aggregation inhibitor (CHEBI:50427) |
| 2-acetamidophenol (CHEBI:143107) has role xenobiotic metabolite (CHEBI:76206) |
| 2-acetamidophenol (CHEBI:143107) is a acetamides (CHEBI:22160) |
| 2-acetamidophenol (CHEBI:143107) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| N-(2-hydroxyphenyl)acetamide |
| Synonyms | Source |
|---|---|
| 2-acetaminophenol | ChemIDplus |
| 2-(acetylamino)phenol | ChEBI |
| 2-(N-acetylamino)phenol | ChEBI |
| 2-hydroxyacetanilide | HMDB |
| 2'-hydroxyacetanilide | ChemIDplus |
| acet-o-aminofenol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2-acetamidophenol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 5Q1J | PDB |
| 9KS | PDBeChem |
| HMDB0061919 | HMDB |
| US2005049229 | Patent |
| Citations |
|---|