EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9N2O3SR |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 177.203 |
| Monoisotopic Mass (excl. R groups) | 177.03339 |
| SMILES | *SC[C@H]([NH3+])C(=O)NCC(=O)[O-] |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-substituted L-cysteinylglycine zwitterion (CHEBI:143103) is a organic molecular entity (CHEBI:50860) |
| S-substituted L-cysteinylglycine zwitterion (CHEBI:143103) is tautomer of R-S-Alanylglycine (CHEBI:8744) |
| Incoming Relation(s) |
| S-(1-hydroxy-3-methylhexan-3-yl)-L-cysteinylglycine zwitterion (CHEBI:145804) is a S-substituted L-cysteinylglycine zwitterion (CHEBI:143103) |
| S-benzyl-L-cysteinylglycine zwitterion (CHEBI:145802) is a S-substituted L-cysteinylglycine zwitterion (CHEBI:143103) |
| S-(4-hydroxynonanal-3-yl)-L-cysteinylglycine zwitterion (CHEBI:747436) is a S-substituted L-cysteinylglycine zwitterion (CHEBI:143103) |
| R-S-Alanylglycine (CHEBI:8744) is tautomer of S-substituted L-cysteinylglycine zwitterion (CHEBI:143103) |
| UniProt Name | Source |
|---|---|
| an S-substituted L-cysteinylglycine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-6262 | MetaCyc |