EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H33N3O4 |
| Net Charge | 0 |
| Average Mass | 391.512 |
| Monoisotopic Mass | 391.24711 |
| SMILES | CNC(=O)[C@@H](NC(=O)[C@H](CCCc1ccccc1)[C@H](C)N(O)C=O)C(C)(C)C |
| InChI | InChI=1S/C21H33N3O4/c1-15(24(28)14-25)17(13-9-12-16-10-7-6-8-11-16)19(26)23-18(20(27)22-5)21(2,3)4/h6-8,10-11,14-15,17-18,28H,9,12-13H2,1-5H3,(H,22,27)(H,23,26)/t15-,17+,18+/m0/s1 |
| InChIKey | GHVMTHKJUAOZJP-CGTJXYLNSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.24.* (metalloendopeptidase) inhibitor Any EC 3.4.* (hydrolases acting on peptide bond) inhibitor that interferes with the activity of a metalloendopeptidase (EC 3.4.24.*). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GI254023X (CHEBI:143102) has role antineoplastic agent (CHEBI:35610) |
| GI254023X (CHEBI:143102) has role apoptosis inducer (CHEBI:68495) |
| GI254023X (CHEBI:143102) has role EC 3.4.24.* (metalloendopeptidase) inhibitor (CHEBI:59107) |
| GI254023X (CHEBI:143102) has role matrix metalloproteinase inhibitor (CHEBI:50664) |
| GI254023X (CHEBI:143102) is a L-valine derivative (CHEBI:84129) |
| GI254023X (CHEBI:143102) is a aldehyde (CHEBI:17478) |
| GI254023X (CHEBI:143102) is a hydroxylamines (CHEBI:24709) |
| IUPAC Name |
|---|
| N2-[(2R)-2-{(1S)-1-[formyl(hydroxy)amino]ethyl}-5-phenylpentanoyl]-N,3-dimethyl-L-valinamide |
| Synonyms | Source |
|---|---|
| (2R,3S)-3-(formyl-hydroxyamino)-2-(3-phenyl-1-propyl)butanoic acid [(1S)-2,2-dimethyl-1-methylcarbamoyl-1-propyl]amide | ChEBI |
| (2R)-N-[(1S)-2,2-dimethyl-1-[(methylamino)carbonyl]-propyl]-2-[(1S)-1-[formyl(hydroxy)amino]ethyl]-5-phenylpentanamide | ChEBI |
| GI-254023X | ChEBI |
| GI-4023 | ChEBI |
| GI4023 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:260264-93-5 | ChEBI |
| Citations |
|---|