EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O3 |
| Net Charge | 0 |
| Average Mass | 298.467 |
| Monoisotopic Mass | 298.25079 |
| SMILES | CCCCCCCC/C=C\CCCCCCC(O)C(=O)O |
| InChI | InChI=1S/C18H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18(20)21/h9-10,17,19H,2-8,11-16H2,1H3,(H,20,21)/b10-9- |
| InChIKey | JBSOOFITVPOOSY-KTKRTIGZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyoleic acid (CHEBI:143096) has functional parent oleic acid (CHEBI:16196) |
| 2-hydroxyoleic acid (CHEBI:143096) has role antihypertensive agent (CHEBI:35674) |
| 2-hydroxyoleic acid (CHEBI:143096) has role antineoplastic agent (CHEBI:35610) |
| 2-hydroxyoleic acid (CHEBI:143096) has role apoptosis inducer (CHEBI:68495) |
| 2-hydroxyoleic acid (CHEBI:143096) is a 2-hydroxy fatty acid (CHEBI:10283) |
| 2-hydroxyoleic acid (CHEBI:143096) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| 2-hydroxyoleic acid (CHEBI:143096) is a long-chain fatty acid (CHEBI:15904) |
| 2-hydroxyoleic acid (CHEBI:143096) is conjugate acid of 2-hydroxyoleate (CHEBI:142986) |
| Incoming Relation(s) |
| 2-hydroxyoleate (CHEBI:142986) is conjugate base of 2-hydroxyoleic acid (CHEBI:143096) |
| IUPAC Name |
|---|
| (9Z)-2-hydroxyoctadec-9-enoic acid |
| Synonyms | Source |
|---|---|
| 2-hydroxy-9Z-octadecenoic acid | ChEBI |
| (Z)-2-hydroxyoctadec-9-enoic acid | ChEBI |
| 2-hydroxy-9-cis-octadecenoic acid | ChemIDplus |
| α-hydroxyoleic acid | ChemIDplus |
| 2OHOA | ChEBI |
| cis-2-hydroxy-9-octadecenoic acid | ChEBI |
| Brand Name | Source |
|---|---|
| Minerval | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050540 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:56472-29-8 | ChemIDplus |
| Citations |
|---|