EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N2O2 |
| Net Charge | 0 |
| Average Mass | 180.207 |
| Monoisotopic Mass | 180.08988 |
| SMILES | Nc1ccc(C[C@@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C9H12N2O2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,10-11H2,(H,12,13)/t8-/m1/s1 |
| InChIKey | CMUHFUGDYMFHEI-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-amino-D-phenylalanine (CHEBI:143083) is a 4-aminophenylalanine (CHEBI:143078) |
| 4-amino-D-phenylalanine (CHEBI:143083) is enantiomer of 4-amino-L-phenylalanine (CHEBI:29737) |
| Incoming Relation(s) |
| 4-amino-L-phenylalanine (CHEBI:29737) is enantiomer of 4-amino-D-phenylalanine (CHEBI:143083) |
| IUPAC Name |
|---|
| 4-amino-D-phenylalanine |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-3-(4-aminophenyl)propanoic acid | ChEBI |
| para-amino-D-phenylalanine | ChEBI |
| p-amino-D-phenylalanine | ChEBI |