EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO3 |
| Net Charge | 0 |
| Average Mass | 179.175 |
| Monoisotopic Mass | 179.05824 |
| SMILES | Nc1ccc(CC(=O)C(=O)O)cc1 |
| InChI | InChI=1S/C9H9NO3/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4H,5,10H2,(H,12,13) |
| InChIKey | HWDZIRSKXFAMFU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(4-aminophenyl)pyruvic acid (CHEBI:143077) has functional parent pyruvic acid (CHEBI:32816) |
| 3-(4-aminophenyl)pyruvic acid (CHEBI:143077) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 3-(4-aminophenyl)pyruvic acid (CHEBI:143077) is a substituted aniline (CHEBI:48975) |
| 3-(4-aminophenyl)pyruvic acid (CHEBI:143077) is conjugate acid of 3-(4-aminophenyl)pyruvate (CHEBI:143071) |
| Incoming Relation(s) |
| 3-(4-aminophenyl)pyruvate (CHEBI:143071) is conjugate base of 3-(4-aminophenyl)pyruvic acid (CHEBI:143077) |
| IUPAC Name |
|---|
| 3-(4-aminophenyl)-2-oxopropanoic acid |
| Synonyms | Source |
|---|---|
| 4-aminophenylpyruvic acid | ChEBI |
| p-aminophenylpyruvic acid | ChEBI |
| α-oxo-4-aminobenzenepropanoic acid | ChEBI |
| para-aminophenylpyruvic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:16921-36-1 | ChemIDplus |
| Citations |
|---|