EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H64O14 |
| Net Charge | 0 |
| Average Mass | 756.927 |
| Monoisotopic Mass | 756.42961 |
| SMILES | CC1OC(OC2C(OC3CC4CCC5C(CCC6(C)C5CC5OC7(CCC(CO)CO7)C(C)C56)C4(C)CC3O)OC(CO)C(O)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C39H64O14/c1-17-28-26(53-39(17)10-7-19(14-40)16-48-39)12-23-21-6-5-20-11-25(24(42)13-38(20,4)22(21)8-9-37(23,28)3)50-36-34(32(46)30(44)27(15-41)51-36)52-35-33(47)31(45)29(43)18(2)49-35/h17-36,40-47H,5-16H2,1-4H3 |
| InChIKey | KWJJIZPJGGHBBX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum lycopersicum (ncbitaxon:4081) | leaf (BTO:0000713) | MetaboLights (MTBLS618) | Strain: Solanum lycopersicum cv. Santa Cruz Kada |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tuberoside J (CHEBI:143066) is a steroid saponin (CHEBI:61655) |
| Citations |
|---|