EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:143048 - I(3)-Tocotrienol
| Formula | C28H42O2 |
| Net Charge | 0 |
| Average Mass | 410.642 |
| Monoisotopic Mass | 410.31848 |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC1(C)CCc2cc(O)c(C)c(C)c2O1 |
| InChI | InChI=1S/C28H42O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-19-26(29)23(5)24(6)27(25)30-28/h11,13,15,19,29H,8-10,12,14,16-18H2,1-7H3 |
| InChIKey | OTXNTMVVOOBZCV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum lycopersicum (ncbitaxon:4081) | leaf (BTO:0000713) | MetaboLights (MTBLS618) | Strain: Solanum lycopersicum cv. Santa Cruz Kada |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| I(3)-Tocotrienol (CHEBI:143048) is a tocotrienol (CHEBI:33235) |
| Citations |
|---|