EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17NO |
| Net Charge | 0 |
| Average Mass | 191.274 |
| Monoisotopic Mass | 191.13101 |
| SMILES | CC(=O)C(C)NCCc1ccccc1 |
| InChI | InChI=1S/C12H17NO/c1-10(11(2)14)13-9-8-12-6-4-3-5-7-12/h3-7,10,13H,8-9H2,1-2H3 |
| InChIKey | WGOUDWYOCIOVMG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Staphylococcus schleiferi (ncbitaxon:1295) | - | PubMed (27720237) | Strain: DSM:4807 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(phenethylamino)-butan-2-one (CHEBI:143030) has role antibacterial agent (CHEBI:33282) |
| 3-(phenethylamino)-butan-2-one (CHEBI:143030) has role bacterial metabolite (CHEBI:76969) |
| 3-(phenethylamino)-butan-2-one (CHEBI:143030) is a benzenes (CHEBI:22712) |
| 3-(phenethylamino)-butan-2-one (CHEBI:143030) is a methyl ketone (CHEBI:51867) |
| 3-(phenethylamino)-butan-2-one (CHEBI:143030) is a secondary amino compound (CHEBI:50995) |
| 3-(phenethylamino)-butan-2-one (CHEBI:143030) is a volatile organic compound (CHEBI:134179) |
| 3-(phenethylamino)-butan-2-one (CHEBI:143030) is conjugate base of 3-(phenethylamino)-butan-2-one(1+) (CHEBI:143110) |
| Incoming Relation(s) |
| 3-(phenethylamino)-butan-2-one(1+) (CHEBI:143110) is conjugate acid of 3-(phenethylamino)-butan-2-one (CHEBI:143030) |
| IUPAC Name |
|---|
| 3-[(2-phenylethyl)amino]butan-2-one |
| Synonym | Source |
|---|---|
| schleiferon A | SUBMITTER |
| Citations |
|---|