EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H6N2O6S3 |
| Net Charge | -2 |
| Average Mass | 358.378 |
| Monoisotopic Mass | 357.93990 |
| SMILES | O=C([O-])[C@@H]1CSC(c2nc3ccc(OS(=O)(=O)[O-])cc3s2)=N1 |
| InChI | InChI=1S/C11H8N2O6S3/c14-11(15)7-4-20-9(13-7)10-12-6-2-1-5(3-8(6)21-10)19-22(16,17)18/h1-3,7H,4H2,(H,14,15)(H,16,17,18)/p-2/t7-/m0/s1 |
| InChIKey | LPKFAQWRYNJJRB-ZETCQYMHSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| firefly L-sulfoluciferin(2−) (CHEBI:143028) is a aryl sulfate oxoanion (CHEBI:139371) |
| firefly L-sulfoluciferin(2−) (CHEBI:143028) is a monocarboxylic acid anion (CHEBI:35757) |
| firefly L-sulfoluciferin(2−) (CHEBI:143028) is enantiomer of firefly D-sulfoluciferin(2−) (CHEBI:143025) |
| Incoming Relation(s) |
| firefly D-sulfoluciferin(2−) (CHEBI:143025) is enantiomer of firefly L-sulfoluciferin(2−) (CHEBI:143028) |
| IUPAC Name |
|---|
| (4R)-2-[6-(sulfonatooxy)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylate |
| Synonym | Source |
|---|---|
| L-luciferin O-sulfate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| firefly L-sulfoluciferin | UniProt |
| Citations |
|---|