EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20N6O |
| Net Charge | 0 |
| Average Mass | 396.454 |
| Monoisotopic Mass | 396.16986 |
| SMILES | COc1cccc2c(NCc3ccccc3)nc(-n3c(N)nc4ccccc43)nc12 |
| InChI | InChI=1S/C23H20N6O/c1-30-19-13-7-10-16-20(19)27-23(28-21(16)25-14-15-8-3-2-4-9-15)29-18-12-6-5-11-17(18)26-22(29)24/h2-13H,14H2,1H3,(H2,24,26)(H,25,27,28) |
| InChIKey | NHAMBLRUUJAFOY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ML240 (CHEBI:143014) has role antineoplastic agent (CHEBI:35610) |
| ML240 (CHEBI:143014) is a aromatic amine (CHEBI:33860) |
| ML240 (CHEBI:143014) is a aromatic ether (CHEBI:35618) |
| ML240 (CHEBI:143014) is a benzimidazoles (CHEBI:22715) |
| ML240 (CHEBI:143014) is a primary amino compound (CHEBI:50994) |
| ML240 (CHEBI:143014) is a quinazolines (CHEBI:38530) |
| ML240 (CHEBI:143014) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 2-(2-amino-1H-benzimidazol-1-yl)-N-benzyl-8-methoxyquinazolin-4-amine |
| Synonyms | Source |
|---|---|
| 2-(2-amino-1H-benzo[d]imidazol-1-yl)-N-benzyl-8-methoxyquinazolin-4-amine | ChEBI |
| ML240 | ChEBI |
| 2-(2-amino-1H-benzimidazol-1-yl)-8-methoxy-N-(phenylmethyl)-4-quinazolinamine | ChEBI |
| ML-240 | ChEBI |
| ML 240 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1346527-98-7 | SUBMITTER |
| Citations |
|---|