EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H36O7P2 |
| Net Charge | 0 |
| Average Mass | 450.449 |
| Monoisotopic Mass | 450.19363 |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C20H36O7P2/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-26-29(24,25)27-28(21,22)23/h9,11,13,15H,6-8,10,12,14,16H2,1-5H3,(H,24,25)(H2,21,22,23) |
| InChIKey | OINNEUNVOZHBOX-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| geranylgeranyl diphosphate (CHEBI:15831) is a polyprenyl diphosphate (CHEBI:37531) |
| geranylgeranyl diphosphate (CHEBI:15831) is conjugate acid of geranylgeranyl diphosphate(3−) (CHEBI:57533) |
| Incoming Relation(s) |
| 2-cis,6-trans,10-trans-geranylgeranyl diphosphate (CHEBI:10698) is a geranylgeranyl diphosphate (CHEBI:15831) |
| 2-trans,6-cis,10-trans-geranylgeranyl diphosphate (CHEBI:48862) is a geranylgeranyl diphosphate (CHEBI:15831) |
| 2-trans,6-trans,10-trans-geranylgeranyl diphosphate (CHEBI:48861) is a geranylgeranyl diphosphate (CHEBI:15831) |
| nerylneryl diphosphate (CHEBI:139478) is a geranylgeranyl diphosphate (CHEBI:15831) |
| geranylgeranyl diphosphate(3−) (CHEBI:57533) is conjugate base of geranylgeranyl diphosphate (CHEBI:15831) |
| IUPAC Name |
|---|
| 3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-yl trihydrogen diphosphate |