EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H52O |
| Net Charge | 0 |
| Average Mass | 440.756 |
| Monoisotopic Mass | 440.40182 |
| SMILES | [H][C@@]12CC[C@@]3([H])C(C)(C)[C@@H](O)CC[C@@]34C[C@@]14CC[C@@]1(C)[C@@]2(C)CC[C@]1([H])[C@H](C)CC[C@H](C)C(=C)C |
| InChI | InChI=1S/C31H52O/c1-20(2)21(3)9-10-22(4)23-13-15-29(8)25-12-11-24-27(5,6)26(32)14-16-30(24)19-31(25,30)18-17-28(23,29)7/h21-26,32H,1,9-19H2,2-8H3/t21-,22+,23+,24-,25-,26-,28+,29-,30+,31-/m0/s1 |
| InChIKey | IXHACUTUTOCSJE-HWTFXIFRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tillandsia fasciculata (ncbitaxon:220113) | leaf (BTO:0000713) | PubMed (11473433) | |
| Turraeanthus africanus (ncbitaxon:1672009) | seed (PO:0009010) | PubMed (19688688) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclolaudenol (CHEBI:142990) has parent hydride cycloartane (CHEBI:37778) |
| cyclolaudenol (CHEBI:142990) has role plant metabolite (CHEBI:76924) |
| cyclolaudenol (CHEBI:142990) is a 3β-hydroxy steroid (CHEBI:36836) |
| cyclolaudenol (CHEBI:142990) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| 24(S)-methyl-9β,19-cyclolanost-25-en-3β-ol |
| Synonyms | Source |
|---|---|
| (24S)-24-methylcycloart-25-en-3β-ol | SUBMITTER |
| (3β,9β,24S)-24-methyl-9,19-cyclolanost-25-en-3-ol | IUPAC |
| UniProt Name | Source |
|---|---|
| cyclolaudenol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00045816 | KNApSAcK |
| CPD-22096 | MetaCyc |
| FDB014700 | FooDB |
| HMDB0035911 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:511-61-5 | ChemIDplus |
| CAS:511-61-5 | KNApSAcK |
| Citations |
|---|