EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H29O3 |
| Net Charge | -1 |
| Average Mass | 269.405 |
| Monoisotopic Mass | 269.21222 |
| SMILES | CCCCCC/C=C\CCCCCCC(O)C(=O)[O-] |
| InChI | InChI=1S/C16H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(17)16(18)19/h7-8,15,17H,2-6,9-14H2,1H3,(H,18,19)/p-1/b8-7- |
| InChIKey | MFMJWERISIRPMN-FPLPWBNLSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxypalmitoleate (CHEBI:142989) has functional parent palmitoleate (CHEBI:32372) |
| 2-hydroxypalmitoleate (CHEBI:142989) is a 2-hydroxy fatty acid anion (CHEBI:76176) |
| 2-hydroxypalmitoleate (CHEBI:142989) is a long-chain fatty acid anion (CHEBI:57560) |
| 2-hydroxypalmitoleate (CHEBI:142989) is a monounsaturated fatty acid anion (CHEBI:82680) |
| 2-hydroxypalmitoleate (CHEBI:142989) is conjugate base of 2-hydroxypalmitoleic acid (CHEBI:143026) |
| Incoming Relation(s) |
| 2-hydroxypalmitoleic acid (CHEBI:143026) is conjugate acid of 2-hydroxypalmitoleate (CHEBI:142989) |
| IUPAC Name |
|---|
| (9Z)-2-hydroxyhexadec-9-enoate |
| Synonyms | Source |
|---|---|
| 2-hydroxy-(9Z)-hexadecenoate | SUBMITTER |
| 2-hydroxypalmitoleic acid(1−) | ChEBI |