EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H31NO5 |
| Net Charge | 0 |
| Average Mass | 449.547 |
| Monoisotopic Mass | 449.22022 |
| SMILES | CC(=C\C(C)=C\c1ccc([N+](=O)[O-])cc1)/C=C(C)/C=C(\C)CCc1oc(O)c(C)c(=O)c1C |
| InChI | InChI=1S/C27H31NO5/c1-17(7-12-25-21(5)26(29)22(6)27(30)33-25)13-18(2)14-19(3)15-20(4)16-23-8-10-24(11-9-23)28(31)32/h8-11,13-16,30H,7,12H2,1-6H3/b17-13+,18-14+,19-15+,20-16+ |
| InChIKey | CELSPYRBTSNTTI-AQWWNALJSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| demethyldeoxyspectinabilin (CHEBI:142931) has functional parent deoxyspectinabilin (CHEBI:142843) |
| demethyldeoxyspectinabilin (CHEBI:142931) is a C-nitro compound (CHEBI:35716) |
| demethyldeoxyspectinabilin (CHEBI:142931) is a 4-pyranones (CHEBI:131906) |
| demethyldeoxyspectinabilin (CHEBI:142931) is a enol (CHEBI:33823) |
| demethyldeoxyspectinabilin (CHEBI:142931) is a polyketide (CHEBI:26188) |
| demethyldeoxyspectinabilin (CHEBI:142931) is conjugate acid of demethyldeoxyspectinabilin(1−) (CHEBI:142872) |
| Incoming Relation(s) |
| demethyldeoxyspectinabilin(1−) (CHEBI:142872) is conjugate base of demethyldeoxyspectinabilin (CHEBI:142931) |
| IUPAC Name |
|---|
| 2-hydroxy-3,5-dimethyl-6-[(3E,5E,7E,9E)-3,5,7,9-tetramethyl-10-(4-nitrophenyl)deca-3,5,7,9-tetraen-1-yl]-4H-pyran-4-one |
| Manual Xrefs | Databases |
|---|---|
| CPD-21835 | MetaCyc |
| Citations |
|---|