EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O |
| Net Charge | 0 |
| Average Mass | 424.713 |
| Monoisotopic Mass | 424.37052 |
| SMILES | [H][C@@]12CC[C@@]3([H])[C@H](C)C(=O)CC[C@@]34C[C@@]14CC[C@@]1(C)[C@@]2(C)CC[C@]1([H])[C@H](C)CCC(=C)C(C)C |
| InChI | InChI=1S/C30H48O/c1-19(2)20(3)8-9-21(4)23-12-14-28(7)26-11-10-24-22(5)25(31)13-15-29(24)18-30(26,29)17-16-27(23,28)6/h19,21-24,26H,3,8-18H2,1-2,4-7H3/t21-,22+,23-,24+,26+,27-,28+,29-,30+/m1/s1 |
| InChIKey | NFRXSIOHGADFRG-MEMZBLDGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ammocharis coranica (ncbitaxon:180132) | bulb (BTO:0000159) | PubMed (10846753) | |
| Eucommia ulmoides (ncbitaxon:4392) | bark (BTO:0001301) | PubMed (26767291) | |
| Musa x paradisiaca (ncbitaxon:89151) | - | PubMed (24916706) | Isolated from fruit peel. |
| Quercus variabilis (ncbitaxon:103481) | - | PubMed (23869388) | Isolated from stem and leaf. |
| Solanum cernuum (ncbitaxon:397274) | leaf (BTO:0000713) | PubMed (18810993) | |
| Tinospora crispa (ncbitaxon:285591) | stem (BTO:0001300) | PubMed (12413712) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cycloeucalenone (CHEBI:142915) has parent hydride 5α-ergostane (CHEBI:20652) |
| cycloeucalenone (CHEBI:142915) has role plant metabolite (CHEBI:76924) |
| cycloeucalenone (CHEBI:142915) is a 3-oxo-5α-steroid (CHEBI:13601) |
| cycloeucalenone (CHEBI:142915) is a cyclic terpene ketone (CHEBI:36130) |
| cycloeucalenone (CHEBI:142915) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| 4α,14-dimethyl-9β,19-cyclo-5α-ergost-24(28)-en-3-one |
| Synonym | Source |
|---|---|
| (4α,5α,9β)-4,14-dimethyl-9,19-cycloergost-24(28)-en-3-one | ChEBI |
| UniProt Name | Source |
|---|---|
| cycloeucalenone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12868 | MetaCyc |
| FDB002378 | FooDB |
| HMDB0030507 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1255-12-5 | FooDB |
| Citations |
|---|