EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O5 |
| Net Charge | 0 |
| Average Mass | 210.185 |
| Monoisotopic Mass | 210.05282 |
| SMILES | COc1cc(C(=O)CC(=O)O)ccc1O |
| InChI | InChI=1S/C10H10O5/c1-15-9-4-6(2-3-7(9)11)8(12)5-10(13)14/h2-4,11H,5H2,1H3,(H,13,14) |
| InChIKey | ZTQKYNMYEBUAFC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vanilloylacetic acid (CHEBI:142914) has functional parent dihydroferulic acid (CHEBI:86612) |
| vanilloylacetic acid (CHEBI:142914) is a 3-oxo monocarboxylic acid (CHEBI:47881) |
| vanilloylacetic acid (CHEBI:142914) is a aromatic ether (CHEBI:35618) |
| vanilloylacetic acid (CHEBI:142914) is a aromatic ketone (CHEBI:76224) |
| vanilloylacetic acid (CHEBI:142914) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| 3-(4-hydroxy-3-methoxyphenyl)-3-oxopropanoyl-CoA (CHEBI:142889) has functional parent vanilloylacetic acid (CHEBI:142914) |
| IUPAC Names |
|---|
| 3-(4-hydroxy-3-methoxyphenyl)-3-oxopropanoic acid |
| 3-(4-hydroxy-3-methoxyphenyl)-3-oxopropionic acid |
| Synonyms | Source |
|---|---|
| 3-(4-hydroxy-3-methoxyphenyl)-3-keto-propionic acid | ChEBI |
| 4-hydroxy-3-methoxybenzoylacetic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:84272-48-0 | PubChem Compound |