EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28O14 |
| Net Charge | 0 |
| Average Mass | 564.496 |
| Monoisotopic Mass | 564.14791 |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2c([C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)c(O)c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)c12 |
| InChI | InChI=1S/C26H28O14/c27-6-13-18(32)21(35)23(37)26(40-13)15-19(33)14-10(29)5-12(8-1-3-9(28)4-2-8)39-24(14)16(20(15)34)25-22(36)17(31)11(30)7-38-25/h1-5,11,13,17-18,21-23,25-28,30-37H,6-7H2/t11-,13-,17+,18-,21+,22-,23-,25+,26+/m1/s1 |
| InChIKey | MMDUKUSNQNWVET-MCIQUCDDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vitex lucens (ncbitaxon:384982) | wood (BTO:0005516) | Article (Seikel, M.K., Chow, J.H.S. and Feldman, L. (1966) The glycoflavonoid pigments of Vitex lucens wood. Phytochemistry, 5(3), 439-455.) | |
| Desmodium styracifolium (ncbitaxon:648866) | - | PubMed (30223921) | |
| Cymbidium kanran (ncbitaxon:112611) | - | PubMed (29156555) | |
| Trigonella foenum-graecum (ncbitaxon:78534) | seed (PO:0009010) | PubMed (25393509) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vicenin-3 (CHEBI:142905) has functional parent isovitexin (CHEBI:18330) |
| vicenin-3 (CHEBI:142905) has role plant metabolite (CHEBI:76924) |
| vicenin-3 (CHEBI:142905) is a C-glycosyl compound (CHEBI:20857) |
| vicenin-3 (CHEBI:142905) is a trihydroxyflavone (CHEBI:27116) |
| Synonyms | Source |
|---|---|
| vicenin 3 | ChemIDplus |
| vicenin III | ChEBI |
| 2-(4-hydroxyphenyl)-5,7-dihydroxy-6-β-D-glucopyranosyl-8-β-D-xylopyranosyl-4H-1-benzopyran-4-one | ChEBI |
| 6-β-D-glucopyranosyl-8-β-D-xylopyranosylapigenin | ChEBI |
| 5,7-dihydroxy-2-(4-hydroxyphenyl)-6-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl]-8-[(2S,3R,4S,5R)-3,4,5-trihydroxytetrahydro-2H-pyran-2-yl]-4H-chromen-4-one | ChEBI |
| apigenin 8-C-xyloside-6-C-glucoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:59914-91-9 | ChemIDplus |
| CAS:59914-91-9 | KNApSAcK |
| Citations |
|---|