EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO4P.H4N |
| Net Charge | 0 |
| Average Mass | 198.159 |
| Monoisotopic Mass | 198.07694 |
| SMILES | CP(=O)([O-])CC[C@H]([NH3+])C(=O)[O-].[NH4+] |
| InChI | InChI=1S/C5H12NO4P.H3N/c1-11(9,10)3-2-4(6)5(7)8;/h4H,2-3,6H2,1H3,(H,7,8)(H,9,10);1H3/t4-;/m0./s1 |
| InChIKey | ZBMRKNMTMPPMMK-WCCKRBBISA-N |
| Roles Classification |
|---|
| Biological Role: | EC 6.3.1.2 (glutamate--ammonia ligase) inhibitor An EC 6.3.* (C‒N bond-forming ligase) inhibitor that interferes with the action of glutamate—ammonia ligase (EC 6.3.1.2). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glufosinate-P-ammonium (CHEBI:142860) has part glufosinate-P zwitterion(1−) (CHEBI:142859) |
| glufosinate-P-ammonium (CHEBI:142860) has role agrochemical (CHEBI:33286) |
| glufosinate-P-ammonium (CHEBI:142860) has role EC 6.3.1.2 (glutamate—ammonia ligase) inhibitor (CHEBI:24319) |
| glufosinate-P-ammonium (CHEBI:142860) has role herbicide (CHEBI:24527) |
| glufosinate-P-ammonium (CHEBI:142860) is a ammonium salt (CHEBI:47704) |
| IUPAC Names |
|---|
| ammonium (2S)-2-amino-4-(methylphosphinato)butyric acid |
| ammonium (2S)-2-azaniumyl-4-(methylphosphinato)butanoate |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-4-(hydroxymethylphosphinyl)butanoic acid monoammonium salt | Alan Wood's Pesticides |
| ammonium [(3S)-3-amino-3-carboxypropyl]methylphosphinate | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 21442053 | ChemSpider |
| derivatives/glufosinate-p-ammonium | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:30817302 | Reaxys |
| CAS:73777-50-1 | ChemIDplus |
| CAS:73777-50-1 | Alan Wood's Pesticides |