EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H45O3 |
| Net Charge | -1 |
| Average Mass | 441.676 |
| Monoisotopic Mass | 441.33742 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC(=C)C(C)C)[C@@]1(C)CC[C@@]1([H])C2=CC[C@@]2([H])[C@H](C(=O)[O-])[C@@H](O)CC[C@]12C |
| InChI | InChI=1S/C29H46O3/c1-17(2)18(3)7-8-19(4)21-11-12-22-20-9-10-24-26(27(31)32)25(30)14-16-29(24,6)23(20)13-15-28(21,22)5/h9,17,19,21-26,30H,3,7-8,10-16H2,1-2,4-6H3,(H,31,32)/p-1/t19-,21-,22+,23+,24+,25+,26+,28-,29-/m1/s1 |
| InChIKey | URESBFJPXATWDO-QFCGGAEGSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3β-hydroxy-5α-ergosta-7,24(28)-diene-4α-carboxylate (CHEBI:142850) is a steroid acid anion (CHEBI:50160) |
| 3β-hydroxy-5α-ergosta-7,24(28)-diene-4α-carboxylate (CHEBI:142850) is conjugate base of 3β-hydroxy-5α-ergosta-7,24(28)-diene-4α-carboxylic acid (CHEBI:145340) |
| Incoming Relation(s) |
| 3β-hydroxy-5α-ergosta-7,24(28)-diene-4α-carboxylic acid (CHEBI:145340) is conjugate acid of 3β-hydroxy-5α-ergosta-7,24(28)-diene-4α-carboxylate (CHEBI:142850) |
| IUPAC Name |
|---|
| 3β-hydroxy-5α-ergosta-7,24(28)-diene-4α-carboxylate |
| Synonyms | Source |
|---|---|
| (3β,4α,5α)-3-hydroxyergosta-7,24(28)-diene-4-carboxylate | IUPAC |
| 4α-carboxylato-ergosta-7,24(241)-dien-3β-ol | ChEBI |
| UniProt Name | Source |
|---|---|
| 4α-carboxy-ergosta-7,24(241)-dien-3β-ol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12909 | MetaCyc |
| Citations |
|---|