EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H31NO6 |
| Net Charge | 0 |
| Average Mass | 477.557 |
| Monoisotopic Mass | 477.21514 |
| SMILES | [H][C@]1(c2oc(OC)c(C)c(=O)c2C)C/C(=C/C(C)=C/C(C)=C/C(C)=C/c2ccc([N+](=O)[O-])cc2)CO1 |
| InChI | InChI=1S/C28H31NO6/c1-17(11-18(2)13-22-7-9-24(10-8-22)29(31)32)12-19(3)14-23-15-25(34-16-23)27-20(4)26(30)21(5)28(33-6)35-27/h7-14,25H,15-16H2,1-6H3/b17-11+,18-13+,19-12+,23-14-/t25-/m1/s1 |
| InChIKey | IZICQJAGBLBAMJ-QDYRYYKCSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces spectabilis (ncbitaxon:68270) | - | Article (Tetrahedron, 1976, 32(2), 217-222) |
| Roles Classification |
|---|
| Biological Roles: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. antiviral agent A substance that destroys or inhibits replication of viruses. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Applications: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spectinabilin (CHEBI:142841) has functional parent deoxyspectinabilin (CHEBI:142843) |
| spectinabilin (CHEBI:142841) has role antiplasmodial drug (CHEBI:64915) |
| spectinabilin (CHEBI:142841) has role antiviral agent (CHEBI:22587) |
| spectinabilin (CHEBI:142841) has role bacterial metabolite (CHEBI:76969) |
| spectinabilin (CHEBI:142841) has role nematicide (CHEBI:25491) |
| spectinabilin (CHEBI:142841) is a C-nitro compound (CHEBI:35716) |
| spectinabilin (CHEBI:142841) is a 4-pyranones (CHEBI:131906) |
| spectinabilin (CHEBI:142841) is a ketene acetal (CHEBI:145408) |
| spectinabilin (CHEBI:142841) is a oxolanes (CHEBI:26912) |
| spectinabilin (CHEBI:142841) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| 2-methoxy-3,5-dimethyl-6-{(2R,4Z)-4-[(2E,4E,6E)-2,4,6-trimethyl-7-(4-nitrophenyl)hepta-2,4,6-trien-1-ylidene]tetrahydrofuran-2-yl}-4H-pyran-4-one |
| Synonyms | Source |
|---|---|
| (+)-neoaureothin | ChEBI |
| neoaureothin | MetaCyc |
| (+)-spectinabilin | ChEBI |
| UniProt Name | Source |
|---|---|
| spectinabilin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-21806 | MetaCyc |
| Spectinabilin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:28900-27-8 | ChemIDplus |
| CAS:59795-94-7 | ChemIDplus |
| Citations |
|---|