EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H31NO6 |
| Net Charge | 0 |
| Average Mass | 477.557 |
| Monoisotopic Mass | 477.21514 |
| SMILES | [H][C@]1(c2oc(OC)c(C)c(=O)c2C)C/C(=C/C(C)=C/C(C)=C/C(C)=C/c2ccc([N+](=O)[O-])cc2)CO1 |
| InChI | InChI=1S/C28H31NO6/c1-17(11-18(2)13-22-7-9-24(10-8-22)29(31)32)12-19(3)14-23-15-25(34-16-23)27-20(4)26(30)21(5)28(33-6)35-27/h7-14,25H,15-16H2,1-6H3/b17-11+,18-13+,19-12+,23-14-/t25-/m1/s1 |
| InChIKey | IZICQJAGBLBAMJ-QDYRYYKCSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces spectabilis (ncbitaxon:68270) | - | Article (Tetrahedron, 1976, 32(2), 217-222) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spectinabilin (CHEBI:142841) has functional parent deoxyspectinabilin (CHEBI:142843) |
| spectinabilin (CHEBI:142841) has role antiplasmodial drug (CHEBI:64915) |
| spectinabilin (CHEBI:142841) has role antiviral agent (CHEBI:22587) |
| spectinabilin (CHEBI:142841) has role bacterial metabolite (CHEBI:76969) |
| spectinabilin (CHEBI:142841) has role nematicide (CHEBI:25491) |
| spectinabilin (CHEBI:142841) is a C-nitro compound (CHEBI:35716) |
| spectinabilin (CHEBI:142841) is a 4-pyranones (CHEBI:131906) |
| spectinabilin (CHEBI:142841) is a ketene acetal (CHEBI:145408) |
| spectinabilin (CHEBI:142841) is a oxolanes (CHEBI:26912) |
| spectinabilin (CHEBI:142841) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| 2-methoxy-3,5-dimethyl-6-{(2R,4Z)-4-[(2E,4E,6E)-2,4,6-trimethyl-7-(4-nitrophenyl)hepta-2,4,6-trien-1-ylidene]tetrahydrofuran-2-yl}-4H-pyran-4-one |
| Synonyms | Source |
|---|---|
| neoaureothin | MetaCyc |
| (+)-spectinabilin | ChEBI |
| (+)-neoaureothin | ChEBI |
| UniProt Name | Source |
|---|---|
| spectinabilin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-21806 | MetaCyc |
| Spectinabilin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:59795-94-7 | ChemIDplus |
| CAS:28900-27-8 | ChemIDplus |
| Citations |
|---|