EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27N7O |
| Net Charge | 0 |
| Average Mass | 417.517 |
| Monoisotopic Mass | 417.22771 |
| SMILES | CC[C@H](CO)Nc1nc(Nc2cccc(-c3ccccn3)c2)c2ncn(C(C)C)c2n1 |
| InChI | InChI=1S/C23H27N7O/c1-4-17(13-31)27-23-28-21(20-22(29-23)30(14-25-20)15(2)3)26-18-9-7-8-16(12-18)19-10-5-6-11-24-19/h5-12,14-15,17,31H,4,13H2,1-3H3,(H2,26,27,28,29)/t17-/m1/s1 |
| InChIKey | LWANFAFTTOKZAX-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-DRF053 (CHEBI:142838) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| (R)-DRF053 (CHEBI:142838) is a 2,6-diaminopurines (CHEBI:38001) |
| (R)-DRF053 (CHEBI:142838) is a phenylpyridine (CHEBI:38193) |
| (R)-DRF053 (CHEBI:142838) is a primary alcohol (CHEBI:15734) |
| (R)-DRF053 (CHEBI:142838) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| (R)-DRF053 hydrochloride hydrate (CHEBI:142835) has part (R)-DRF053 (CHEBI:142838) |
| IUPAC Name |
|---|
| (2R)-2-({9-isopropyl-6-[3-(pyridin-2-yl)anilino]-9H-purin-2-yl}amino)butan-1-ol |
| Citations |
|---|