EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15NO2 |
| Net Charge | 0 |
| Average Mass | 229.279 |
| Monoisotopic Mass | 229.11028 |
| SMILES | Cc1oc(C)c(C(=O)Nc2ccccc2)c1C |
| InChI | InChI=1S/C14H15NO2/c1-9-10(2)17-11(3)13(9)14(16)15-12-7-5-4-6-8-12/h4-8H,1-3H3,(H,15,16) |
| InChIKey | ZWJNEYVWPYIKMB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methfuroxam (CHEBI:142825) has role antifungal agrochemical (CHEBI:86328) |
| methfuroxam (CHEBI:142825) is a anilide (CHEBI:13248) |
| methfuroxam (CHEBI:142825) is a furanilide fungicide (CHEBI:87019) |
| methfuroxam (CHEBI:142825) is a furans (CHEBI:24129) |
| methfuroxam (CHEBI:142825) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Names |
|---|
| 2,4,5-trimethyl-N-phenyl-3-furamide |
| 2,4,5-trimethyl-N-phenylfuran-3-carboxamide |
| Synonyms | Source |
|---|---|
| 2,4,5-trimethyl-3-furanilide | Alan Wood's Pesticides |
| 2,4,5-trimethyl-N-phenyl-3-furancarboxamide | Alan Wood's Pesticides |
| méthfuroxame | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 455 | PPDB |
| GB2021951 | Patent |
| methfuroxam | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6397976 | Reaxys |
| CAS:28730-17-8 | Alan Wood's Pesticides |
| CAS:28730-17-8 | ChemIDplus |
| Citations |
|---|