EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H28N4O |
| Net Charge | 0 |
| Average Mass | 448.570 |
| Monoisotopic Mass | 448.22631 |
| SMILES | [H][C@]1(Cc2nccc3c2nc2ccccc23)C[C@@]2([H])c3nc4ccc(O)cc4c3CCN2C/C1=C/C |
| InChI | InChI=1S/C29H28N4O/c1-2-17-16-33-12-10-22-23-15-19(34)7-8-25(23)32-29(22)27(33)14-18(17)13-26-28-21(9-11-30-26)20-5-3-4-6-24(20)31-28/h2-9,11,15,18,27,31-32,34H,10,12-14,16H2,1H3/b17-2-/t18-,27-/m0/s1 |
| InChIKey | VEYHRCHVRDHUPQ-JKCZZUPASA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-hydroxyusambarensine (CHEBI:142807) is a monoterpenoid indole alkaloid (CHEBI:65323) |