EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18F3N3O3 |
| Net Charge | 0 |
| Average Mass | 345.321 |
| Monoisotopic Mass | 345.13003 |
| SMILES | CC(=O)N1CCC(NC(=O)Nc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H18F3N3O3/c1-10(22)21-8-6-12(7-9-21)20-14(23)19-11-2-4-13(5-3-11)24-15(16,17)18/h2-5,12H,6-9H2,1H3,(H2,19,20,23) |
| InChIKey | UAKAZEQUWPXSOS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.3.2.10 (soluble epoxide hydrolase) inhibitor Any inhibitor of soluble epoxide hydrolase, a bifunctional enzyme that in humans is encoded by the EPHX2 gene.Found in both the cytosol and peroxisomes it binds to specific epoxides and converts them into the corresponding diols. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(1-acetylpiperidin-4-yl)-N'-[4-(trifluoromethoxy)phenyl]urea (CHEBI:142791) has role EC 3.3.2.10 (soluble epoxide hydrolase) inhibitor (CHEBI:142790) |
| N-(1-acetylpiperidin-4-yl)-N'-[4-(trifluoromethoxy)phenyl]urea (CHEBI:142791) is a phenylureas (CHEBI:134043) |
| IUPAC Name |
|---|
| N-(1-acetylpiperidin-4-yl)-N'-[4-(trifluoroacetyl)phenyl]urea |
| Synonym | Source |
|---|---|
| sEHi, #1555 | ChEBI |
| Citations |
|---|