EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H15F7N4O2 |
| Net Charge | 0 |
| Average Mass | 464.341 |
| Monoisotopic Mass | 464.10832 |
| SMILES | CC(=O)N1C(=O)N(NCc2cccnc2)Cc2cc(C(F)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C19H15F7N4O2/c1-11(31)30-15-5-4-14(17(20,18(21,22)23)19(24,25)26)7-13(15)10-29(16(30)32)28-9-12-3-2-6-27-8-12/h2-8,28H,9-10H2,1H3 |
| InChIKey | MIOBBYRMXGNORL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | TRPV channel modulator Any transient receptor potential (TRP) channel modulator that modulates the TRPV channels (V = vanilloid). There is strong evidence that action at one or more of this class of proteins is responsible for the insecticidal action of pymetrozine, pyrifluquinazon, and afidopyropen. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrifluquinazon (CHEBI:142784) has role agrochemical (CHEBI:33286) |
| pyrifluquinazon (CHEBI:142784) has role insecticide (CHEBI:24852) |
| pyrifluquinazon (CHEBI:142784) has role TRPV channel modulator (CHEBI:142782) |
| pyrifluquinazon (CHEBI:142784) is a acetamides (CHEBI:22160) |
| pyrifluquinazon (CHEBI:142784) is a organofluorine compound (CHEBI:37143) |
| pyrifluquinazon (CHEBI:142784) is a pyridines (CHEBI:26421) |
| pyrifluquinazon (CHEBI:142784) is a quinazolines (CHEBI:38530) |
| IUPAC Name |
|---|
| 1-acetyl-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-[(pyridin-3-ylmethyl)amino]-3,4-dihydroquinazolin-2(1H)-one |
| Synonyms | Source |
|---|---|
| pyrifluquinazone | ChEBI |
| 1-acetyl-1,2,3,4-tetrahydro-3-[(3-pyridylmethyl)amino]-6-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]quinazolin-2-one | Alan Wood's Pesticides |
| 1-acetyl-3,4-dihydro-3-[(3-pyridinylmethyl)amino]-6-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-2(1H)-quinazolinone | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| pyrifluquinazon | Alan Wood's Pesticides |
| 1366 | PPDB |
| Registry Numbers | Sources |
|---|---|
| CAS:337458-27-2 | Alan Wood's Pesticides |
| CAS:337458-27-2 | ChemIDplus |
| Citations |
|---|