EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20ClN3O4 |
| Net Charge | 0 |
| Average Mass | 389.839 |
| Monoisotopic Mass | 389.11423 |
| SMILES | Cc1cccc(C2CC2)c1Oc1nnc(Cl)cc1OC(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H20ClN3O4/c1-12-3-2-4-14(13-5-6-13)17(12)27-18-15(11-16(20)21-22-18)26-19(24)23-7-9-25-10-8-23/h2-4,11,13H,5-10H2,1H3 |
| InChIKey | BXIGJZDQFDFASM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.5.1.117 (homogentisate solanesyltransferase) inhibitor Any EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of (homogentisate solanesyltransferase (EC 2.5.1.117). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclopyrimorate (CHEBI:142780) has role agrochemical (CHEBI:33286) |
| cyclopyrimorate (CHEBI:142780) has role EC 2.5.1.117 (homogentisate solanesyltransferase) inhibitor (CHEBI:142781) |
| cyclopyrimorate (CHEBI:142780) has role herbicide (CHEBI:24527) |
| cyclopyrimorate (CHEBI:142780) is a aromatic ether (CHEBI:35618) |
| cyclopyrimorate (CHEBI:142780) is a carbamate ester (CHEBI:23003) |
| cyclopyrimorate (CHEBI:142780) is a cyclopropanes (CHEBI:51454) |
| cyclopyrimorate (CHEBI:142780) is a morpholines (CHEBI:38785) |
| cyclopyrimorate (CHEBI:142780) is a organochlorine compound (CHEBI:36683) |
| cyclopyrimorate (CHEBI:142780) is a pyridazines (CHEBI:37921) |
| IUPAC Name |
|---|
| 6-chloro-3-(2-cyclopropyl-6-methylphenoxy)pyridazin-4-yl morpholine-4-carboxylate |
| Synonyms | Source |
|---|---|
| 6-chloro-3-(2-cyclopropyl-6-methylphenoxy)-4-pyridazinyl 4-morpholinecarboxylate | Alan Wood's Pesticides |
| H-965 | ChemIDplus |
| SW-065 | ChemIDplus |
| Brand Name | Source |
|---|---|
| CYRA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2627 | PPDB |
| cyclopyrimorate | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11895712 | Reaxys |
| CAS:499231-24-2 | Alan Wood's Pesticides |
| CAS:499231-24-2 | ChemIDplus |
| Citations |
|---|