EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:142778 - petrobactin(1+)
| Formula | C34H51N6O11 |
| Net Charge | +1 |
| Average Mass | 719.813 |
| Monoisotopic Mass | 719.36103 |
| SMILES | O=C(CC(O)(CC(=O)NCCC[NH2+]CCCCNC(=O)c1ccc(O)c(O)c1)C(=O)[O-])NCCC[NH2+]CCCCNC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C34H50N6O11/c41-25-9-7-23(19-27(25)43)31(47)39-15-3-1-11-35-13-5-17-37-29(45)21-34(51,33(49)50)22-30(46)38-18-6-14-36-12-2-4-16-40-32(48)24-8-10-26(42)28(44)20-24/h7-10,19-20,35-36,41-44,51H,1-6,11-18,21-22H2,(H,37,45)(H,38,46)(H,39,47)(H,40,48)(H,49,50)/p+1 |
| InChIKey | SESZZOOISCLDTE-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Chemical Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| Biological Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| petrobactin(1+) (CHEBI:142778) has role siderophore (CHEBI:26672) |
| petrobactin(1+) (CHEBI:142778) is a organic molecular entity (CHEBI:50860) |
| UniProt Name | Source |
|---|---|
| petrobactin | UniProt |
| Citations |
|---|