EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27N2O4 |
| Net Charge | +1 |
| Average Mass | 395.479 |
| Monoisotopic Mass | 395.19653 |
| SMILES | [H][C@]12CC[N+](=C/C1=C/C)CCc1c(nc3ccccc13)[C@@]2(COC(C)=O)C(=O)OC |
| InChI | InChI=1S/C23H27N2O4/c1-4-16-13-25-11-9-18-17-7-5-6-8-20(17)24-21(18)23(22(27)28-3,14-29-15(2)26)19(16)10-12-25/h4-8,13,19,24H,9-12,14H2,1-3H3/q+1/b16-4-/t19-,23-/m0/s1 |
| InChIKey | YCGQEMDBJBQBSW-ISNKGDJGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| precondylocarpine acetate (CHEBI:142769) is a acetate ester (CHEBI:47622) |
| precondylocarpine acetate (CHEBI:142769) is a methyl ester (CHEBI:25248) |
| precondylocarpine acetate (CHEBI:142769) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| precondylocarpine acetate (CHEBI:142769) is a organic cation (CHEBI:25697) |
| precondylocarpine acetate (CHEBI:142769) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| (5E,6S,7S)-7-(acetoxymethyl)-5-ethylidene-7-(methoxycarbonyl)-1,2,5,6,7,8-hexahydro-3,6-ethanoazonino[5,4-b]indol-3-ium |
| UniProt Name | Source |
|---|---|
| precondylocarpine acetate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-21551 | MetaCyc |
| Citations |
|---|