EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H38NO18 |
| Net Charge | 0 |
| Average Mass | 616.546 |
| Monoisotopic Mass | 616.20889 |
| SMILES | *[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[C@]3(C(=O)O)C[C@H](O)[C@@H](NC(C)=O)[C@]([H])([C@H](O)[C@H](O)CO)O3)[C@H]2O)[C@H](O)[C@H]1O |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-Neu5Ac-(2→3)-β-D-Gal-(1→4)-β-D-Glc-yl group (CHEBI:142767) has role epitope (CHEBI:53000) |
| α-Neu5Ac-(2→3)-β-D-Gal-(1→4)-β-D-Glc-yl group (CHEBI:142767) is a β-D-glucosyl group (CHEBI:30697) |
| α-Neu5Ac-(2→3)-β-D-Gal-(1→4)-β-D-Glc-yl group (CHEBI:142767) is substituent group from N-acetyl-α-neuraminyl-(2→3)-β-D-galactosyl-(1→4)-β-D-glucose (CHEBI:59226) |
| Incoming Relation(s) |
| α-N-acetylneuraminyl-(2→3)-β-D-galactosyl-(1→4)-β-D-glucosyl-(1↔1')-ceramide (CHEBI:15681) has part α-Neu5Ac-(2→3)-β-D-Gal-(1→4)-β-D-Glc-yl group (CHEBI:142767) |
| IUPAC Name |
|---|
| 5-acetamido-3,5-dideoxy-D-glycero-α-D-galacto-non-2-ulopyranonosyl-(2→3)-β-D-galactopyranosyl-(1→4)-β-D-glucopyranosyl |
| Synonyms | Source |
|---|---|
| 3'-sialyllactosyl | ChEBI |
| Neu5Acα2-3Galβ1-4Glcβ-yl | ChEBI |
| α-N-acetylneuraminyl-(2→3)-β-D-galactosyl-(1→4)-β-D-glucosyl | ChEBI |
| α-Neu5Ac-(2→3)-β-D-Galp-(1→4)-β-D-Glcp-yl | ChEBI |
| Citations |
|---|