EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O8 |
| Net Charge | 0 |
| Average Mass | 220.133 |
| Monoisotopic Mass | 220.02192 |
| SMILES | O=C(O)C[C@@](O)(CC(=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H8O8/c8-3(5(11)12)1-7(15,6(13)14)2-4(9)10/h15H,1-2H2,(H,9,10)(H,11,12)(H,13,14)/t7-/m0/s1 |
| InChIKey | RQMCNDRMPZBEOD-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-hydroxy-4-oxobutane-1,2,4-tricarboxylic acid (CHEBI:142757) is a 2-hydroxy-4-oxobutane-1,2,4-tricarboxylic acid (CHEBI:17250) |
| (2S)-2-hydroxy-4-oxobutane-1,2,4-tricarboxylic acid (CHEBI:142757) is conjugate acid of (2S)-2-hydroxy-4-oxobutane-1,2,4-tricarboxylate (CHEBI:142706) |
| Incoming Relation(s) |
| (2S)-2-hydroxy-4-oxobutane-1,2,4-tricarboxylate (CHEBI:142706) is conjugate base of (2S)-2-hydroxy-4-oxobutane-1,2,4-tricarboxylic acid (CHEBI:142757) |
| IUPAC Name |
|---|
| (2S)-2-hydroxy-4-oxobutane-1,2,4-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| (4S)-4-carboxy-4-hydroxy-2-oxoadipic acid | ChEBI |
| (4S)-4-hydroxy-4-carboxymethyl-2-oxoglutaric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 7QD | PDBeChem |