EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:142756 - asulam-potassium
| Formula | C8H9N2O4S.K |
| Net Charge | 0 |
| Average Mass | 268.335 |
| Monoisotopic Mass | 267.99201 |
| SMILES | COC(=O)[N-]S(=O)(=O)c1ccc(N)cc1.[K+] |
| InChI | InChI=1S/C8H10N2O4S.K/c1-14-8(11)10-15(12,13)7-4-2-6(9)3-5-7;/h2-5H,9H2,1H3,(H,10,11);/q;+1/p-1 |
| InChIKey | WKJOGZIRDGAEFO-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | EC 2.5.1.15 (dihydropteroate synthase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of dihydropteroate synthase (EC 2.5.1.15), an enzyme that catalyzes the formation of dihydropteroate from p-aminobenzoic acid and dihydropteridine-hydroxymethyl-pyrophosphate. |
| Applications: | herbicide A substance used to destroy plant pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asulam-potassium (CHEBI:142756) has part asulam(1−) (CHEBI:142669) |
| asulam-potassium (CHEBI:142756) has role agrochemical (CHEBI:33286) |
| asulam-potassium (CHEBI:142756) has role EC 2.5.1.15 (dihydropteroate synthase) inhibitor (CHEBI:50502) |
| asulam-potassium (CHEBI:142756) has role herbicide (CHEBI:24527) |
| asulam-potassium (CHEBI:142756) is a organic potassium salt (CHEBI:50394) |
| IUPAC Names |
|---|
| potassium {[(4-aminophenyl)sulfonyl]imino}(methoxy)methanolate |
| potassium [(4-aminophenyl)sulfonyl](methoxycarbonyl)azanide |
| Synonyms | Source |
|---|---|
| methyl N-[(4-aminophenyl)sulfonyl]carbamate potassium salt (1:1) | Alan Wood's Pesticides |
| potassium asulam | ChemIDplus |
| asulam, potassium salt | ChemIDplus |
| potassium [4-amino(benzene-1-sulfonyl)](methoxycarbonyl)azanide | Alan Wood's Pesticides |
| methyl sulfanilylcarbamate potassium salt | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| derivatives/asulam-potassium | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:14089-43-1 | ChemIDplus |
| CAS:14089-43-1 | Alan Wood's Pesticides |
| Citations |
|---|