EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H27NO4 |
| Net Charge | 0 |
| Average Mass | 273.373 |
| Monoisotopic Mass | 273.19401 |
| SMILES | CCCCCCCCCCCC(=O)N[C@@H](O)C(=O)O |
| InChI | InChI=1S/C14H27NO4/c1-2-3-4-5-6-7-8-9-10-11-12(16)15-13(17)14(18)19/h13,17H,2-11H2,1H3,(H,15,16)(H,18,19)/t13-/m0/s1 |
| InChIKey | JHNQOAIDMUHKEW-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-dodecanoyl-(2S)-hydroxyglycine (CHEBI:142743) has functional parent dodecanoic acid (CHEBI:30805) |
| N-dodecanoyl-(2S)-hydroxyglycine (CHEBI:142743) is a (2S)-α-hydroxyglycine (CHEBI:142739) |
| N-dodecanoyl-(2S)-hydroxyglycine (CHEBI:142743) is conjugate acid of N-dodecanoyl-(2S)-hydroxyglycinate (CHEBI:142693) |
| Incoming Relation(s) |
| N-dodecanoyl-(2S)-hydroxyglycinate (CHEBI:142693) is conjugate base of N-dodecanoyl-(2S)-hydroxyglycine (CHEBI:142743) |
| IUPAC Name |
|---|
| (2S)-(dodecanoylamino)(hydroxy)acetic acid |
| Synonyms | Source |
|---|---|
| (2S)-hydroxy(lauroylamino)acetic acid | ChEBI |
| N-lauroyl-(2S)-hydroxyglycine | ChEBI |
| Citations |
|---|