EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23ClN2O9 |
| Net Charge | 0 |
| Average Mass | 494.884 |
| Monoisotopic Mass | 494.10921 |
| SMILES | [H][C@@]12C[C@@]3([H])C(O)(C(=O)c4c(O)ccc(Cl)c4[C@@]3(C)O)C(=O)[C@]1(O)C(=O)C(C(N)=O)=C([O-])[C@H]2[NH+](C)C |
| InChI | InChI=1S/C22H23ClN2O9/c1-20(32)10-6-7-14(25(2)3)15(27)12(18(24)30)17(29)21(7,33)19(31)22(10,34)16(28)11-9(26)5-4-8(23)13(11)20/h4-5,7,10,14,26-27,32-34H,6H2,1-3H3,(H2,24,30)/t7-,10+,14-,20-,21+,22?/m0/s1 |
| InChIKey | GAPUYPRPRQGEIU-PRVYJEFOSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11a-hydroxychlortetracycline zwitterion (CHEBI:142710) is a an 11a-hydroxytetracyline zwitterion (CHEBI:144645) |
| 11a-hydroxychlortetracycline zwitterion (CHEBI:142710) is a tetracyclines (CHEBI:26895) |
| 11a-hydroxychlortetracycline zwitterion (CHEBI:142710) is a zwitterion (CHEBI:27369) |
| Synonym | Source |
|---|---|
| 11a-hydroxychlortetracycline | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 11a-hydroxychlorotetracycline | UniProt |
| Citations |
|---|