EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9N2O4S.Na |
| Net Charge | 0 |
| Average Mass | 252.227 |
| Monoisotopic Mass | 252.01807 |
| SMILES | COC(=O)[N-]S(=O)(=O)c1ccc(N)cc1.[Na+] |
| InChI | InChI=1S/C8H10N2O4S.Na/c1-14-8(11)10-15(12,13)7-4-2-6(9)3-5-7;/h2-5H,9H2,1H3,(H,10,11);/q;+1/p-1 |
| InChIKey | PEXLHWBDBQUUOG-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | EC 2.5.1.15 (dihydropteroate synthase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of dihydropteroate synthase (EC 2.5.1.15), an enzyme that catalyzes the formation of dihydropteroate from p-aminobenzoic acid and dihydropteridine-hydroxymethyl-pyrophosphate. |
| Applications: | herbicide A substance used to destroy plant pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asulam-sodium (CHEBI:142672) has part asulam(1−) (CHEBI:142669) |
| asulam-sodium (CHEBI:142672) has role agrochemical (CHEBI:33286) |
| asulam-sodium (CHEBI:142672) has role EC 2.5.1.15 (dihydropteroate synthase) inhibitor (CHEBI:50502) |
| asulam-sodium (CHEBI:142672) has role herbicide (CHEBI:24527) |
| asulam-sodium (CHEBI:142672) is a organic sodium salt (CHEBI:38700) |
| IUPAC Names |
|---|
| sodium [(4-aminophenyl)sulfonyl](methoxycarbonyl)azanide |
| sodium {[(4-aminophenyl)sulfonyl]imino}(methoxy)methanolate |
| Synonyms | Source |
|---|---|
| sodium [4-amino(benzene-1-sulfonyl)](methoxycarbonyl)azanide | Alan Wood's Pesticides |
| methyl N-[(4-aminophenyl)sulfonyl]carbamate sodium salt (1:1) | Alan Wood's Pesticides |
| asulam, sodium salt | ChemIDplus |
| methyl sulfanilylcarbamate, sodium salt | ChemIDplus |
| methyl sulfanilylcarbamate sodium salt | ChemIDplus |
| sodium asulam | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| derivatives/asulam-sodium | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:2302-17-2 | Alan Wood's Pesticides |
| CAS:2302-17-2 | ChemIDplus |