EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N2O2 |
| Net Charge | +1 |
| Average Mass | 325.432 |
| Monoisotopic Mass | 325.19105 |
| SMILES | [H][C@@]12CC[NH+](CCc3c(nc4ccccc34)[C@H]1C(=O)OC)C/C2=C/C |
| InChI | InChI=1S/C20H24N2O2/c1-3-13-12-22-10-8-14(13)18(20(23)24-2)19-16(9-11-22)15-6-4-5-7-17(15)21-19/h3-7,14,18,21H,8-12H2,1-2H3/p+1/b13-3-/t14-,18-/m0/s1 |
| InChIKey | FWGFCRSCPPSXQL-IPPALFRBSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (16S)-deshydroxymethyl-stemmadenine(1+) (CHEBI:142671) is a ammonium ion derivative (CHEBI:35274) |
| (16S)-deshydroxymethyl-stemmadenine(1+) (CHEBI:142671) is conjugate acid of (16S)-deshydroxymethyl-stemmadenine (CHEBI:142942) |
| Incoming Relation(s) |
| (16S)-deshydroxymethyl-stemmadenine (CHEBI:142942) is conjugate base of (16S)-deshydroxymethyl-stemmadenine(1+) (CHEBI:142671) |
| IUPAC Name |
|---|
| (5E,6R,7S)-5-ethylidene-7-(methoxycarbonyl)-1,2,3,4,5,6,7,8-octahydro-3,6-ethanoazonino[5,4-b]indol-3-ium |
| Synonym | Source |
|---|---|
| (16S)-deshydroxymethylstemmadenine | ChEBI |
| UniProt Name | Source |
|---|---|
| (16S)-deshydroxymethyl-stemmadenine | UniProt |
| Citations |
|---|